Perylene-3,4,9,10-tetracarboxylic acid

• CAS: 81-32-3
• Catalog Number: ACM81323
• Category: Other Products
• Molecular Weight: 428.34728
• Molecular Formula: C₂₄H₁₂O₈
• Synonyms: perylene-3,4,9,10-tetracarboxylic acid

Custom Q&A

What is the molecular formula of perylene-3,4,9,10-tetracarboxylic acid?

The molecular formula of perylene-3,4,9,10-tetracarboxylic acid is C24H12O8.

What is the molecular weight of perylene-3,4,9,10-tetracarboxylic acid?

The molecular weight of perylene-3,4,9,10-tetracarboxylic acid is 428.3 g/mol.

What is the IUPAC name of perylene-3,4,9,10-tetracarboxylic acid?

The IUPAC name of perylene-3,4,9,10-tetracarboxylic acid is perylene-3,4,9,10-tetracarboxylic acid.

What is the InChI of perylene-3,4,9,10-tetracarboxylic acid?

The InChI of perylene-3,4,9,10-tetracarboxylic acid is InChI=1S/C24H12O8/c25-21(26)13-5-1-9-10-2-6-15(23(29)30)20-16(24(31)32)8-4-12(18(10)20)11-3-7-14(22(27)28)19(13)17(9)11/h1-8H,(H,25,26)(H,27,28)(H,29,30)(H,31,32).

What is the InChIKey of perylene-3,4,9,10-tetracarboxylic acid?

The InChIKey of perylene-3,4,9,10-tetracarboxylic acid is FVDOBFPYBSDRKH-UHFFFAOYSA-N.

What is the canonical SMILES of perylene-3,4,9,10-tetracarboxylic acid?

The canonical SMILES of perylene-3,4,9,10-tetracarboxylic acid is C1=CC(=C2C(=CC=C3C2=C1C4=C5C3=CC=C(C5=C(C=C4)C(=O)O)C(=O)O)C(=O)O)C(=O)O.

What is the CAS number of perylene-3,4,9,10-tetracarboxylic acid?

The CAS number of perylene-3,4,9,10-tetracarboxylic acid is 81-32-3.

What is the EC number of perylene-3,4,9,10-tetracarboxylic acid?

The EC number of perylene-3,4,9,10-tetracarboxylic acid is 201-343-0.

What is the UNII of perylene-3,4,9,10-tetracarboxylic acid?

The UNII of perylene-3,4,9,10-tetracarboxylic acid is N4CM698BCZ.

What is the XLogP3-AA value of perylene-3,4,9,10-tetracarboxylic acid?

The XLogP3-AA value of perylene-3,4,9,10-tetracarboxylic acid is 3.9.