p-Methoxybenzyl S-(4,6-dimethylpyrimidin-2-yl) thiocarbonate

• CAS: 41840-29-3
• Catalog Number: ACM41840293
• Category: Pyrimidines
• Molecular Weight: 304.36
• Molecular Formula: C15H16N2O3S
• Appearance: Powder

Custom Q&A

What is the molecular formula of p-Methoxybenzyl S-(4,6-dimethylpyrimidin-2-yl) thiocarbonate?

The molecular formula is C15H16N2O3S.

What are some synonyms for p-Methoxybenzyl S-(4,6-dimethylpyrimidin-2-yl) thiocarbonate?

Some synonyms include 41840-29-3, S-(4,6-Dimethylpyrimidin-2-yl) O-(p-methoxybenzyl) thiocarbonate, and (4-methoxyphenyl)methyl (4,6-dimethylpyrimidin-2-yl)sulfanylformate.

What is the molecular weight of p-Methoxybenzyl S-(4,6-dimethylpyrimidin-2-yl) thiocarbonate?

The molecular weight is 304.4 g/mol.

What is the IUPAC name of p-Methoxybenzyl S-(4,6-dimethylpyrimidin-2-yl) thiocarbonate?

The IUPAC name is (4-methoxyphenyl)methyl (4,6-dimethylpyrimidin-2-yl)sulfanylformate.

What is the InChI of p-Methoxybenzyl S-(4,6-dimethylpyrimidin-2-yl) thiocarbonate?

The InChI is InChI=1S/C15H16N2O3S/c1-10-8-11(2)17-14(16-10)21-15(18)20-9-12-4-6-13(19-3)7-5-12/h4-8H,9H2,1-3H3.

What is the InChIKey of p-Methoxybenzyl S-(4,6-dimethylpyrimidin-2-yl) thiocarbonate?

The InChIKey is DDIJXDDZBQMPDQ-UHFFFAOYSA-N.

What is the Canonical SMILES of p-Methoxybenzyl S-(4,6-dimethylpyrimidin-2-yl) thiocarbonate?

The Canonical SMILES is CC1=CC(=NC(=N1)SC(=O)OCC2=CC=C(C=C2)OC)C.

What is the CAS number for p-Methoxybenzyl S-(4,6-dimethylpyrimidin-2-yl) thiocarbonate?

The CAS number is 41840-29-3.

How many hydrogen bond acceptors are there in p-Methoxybenzyl S-(4,6-dimethylpyrimidin-2-yl) thiocarbonate?

There are 6 hydrogen bond acceptors.

What is the topological polar surface area of p-Methoxybenzyl S-(4,6-dimethylpyrimidin-2-yl) thiocarbonate?

The topological polar surface area is 86.6 Å2.