Nxl 104

• CAS: 1192491-61-4
• Catalog Number: ACM1192491614
• Category: Other Products
• Molecular Weight: 287.22557
• Molecular Formula: C₇H₁₀N₃NaO₆S
• Synonyms: AvibactaM SodiuM Salt;NXL 104;Sulfuric AcidMono[(1R,2S,5R)-2-(aMinocarbonyl)-7-oxo-1,6-diazabicyclo[3.2.1]oct-6-yl] EsterSodiuM Salt;Avibactam (sodium);AvibactaM SodiuM NXL 104;sodium (1R,2S,5R)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl sulfate;(2S,5R)-7-Oxo-6-(sulfooxy)-1,6-diazabicyclo[3.2.1]octane-2-carboxamide monosodium salt

Custom Q&A

What is the molecular formula of Avibactam sodium?

The molecular formula of Avibactam sodium is C7H10N3NaO6S.

What are the synonyms for Avibactam sodium?

The synonyms for Avibactam sodium include Avibactam Sodium Salt, NXL 104, and NXL-104.

What is the molecular weight of Avibactam sodium?

The molecular weight of Avibactam sodium is 287.23 g/mol.

What is the role of Avibactam sodium?

Avibactam sodium has a role as a beta-lactamase inhibitor, an antibacterial drug, and an antimicrobial agent.

What is the IUPAC name of Avibactam sodium?

The IUPAC name of Avibactam sodium is sodium;[(2S,5R)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate.

What is the Canonical SMILES representation of Avibactam sodium?

The Canonical SMILES representation of Avibactam sodium is C1CC(N2CC1N(C2=O)OS(=O)(=O)[O-])C(=O)N.[Na+].

What is the CAS number for Avibactam sodium?

The CAS number for Avibactam sodium is 396731-20-7.

How many hydrogen bond acceptor count does Avibactam sodium have?

Avibactam sodium has 6 hydrogen bond acceptor count.

What is the exact mass of Avibactam sodium?

The exact mass of Avibactam sodium is 287.01880050 g/mol.

What is the topological polar surface area of Avibactam sodium?

The topological polar surface area of Avibactam sodium is 141 Å2.