N-acetyl-5-bromo-3-hydroxyindole

• CAS: 114165-30-9
• Catalog Number: ACM114165309
• Category: Bromine Series
• Molecular Weight: 254.08
• Molecular Formula: C₁₀H₈BrNO₂
• Synonyms: 1-ACETYL-5-BROMO-INDOXYL-3-OL;1-ACETYL-5-BROMOINDOL-3-OL;1-ACETYL-5-BROMO-3-HYDROXYINDOLE;N-ACETYL-5-BROMO-3-HYDROXYINDOLE;1-acetyl-5-bromo-1h-indol-3-o;1-Acetyl-5-bromo-3-hydroxy-1H-indole;1-Acetyl-5-bromo-1H-indol-3-ol;1-ACETYL-5-BROMOINDOL-3-OL(1Ac5Br
• Density: 1.65 g/cm³

Custom Q&A

What is the molecular formula of N-acetyl-5-bromo-3-hydroxyindole?

The molecular formula is C10H8BrNO2.

What is the molecular weight of N-acetyl-5-bromo-3-hydroxyindole?

The molecular weight is 254.08 g/mol.

What is the IUPAC name of N-acetyl-5-bromo-3-hydroxyindole?

The IUPAC name is 1-(5-bromo-3-hydroxyindol-1-yl)ethanone.

What is the InChI of N-acetyl-5-bromo-3-hydroxyindole?

The InChI is InChI=1S/C10H8BrNO2/c1-6(13)12-5-10(14)8-4-7(11)2-3-9(8)12/h2-5,14H,1H3.

What is the InChIKey of N-acetyl-5-bromo-3-hydroxyindole?

The InChIKey is WOLVOYIZHIXSSE-UHFFFAOYSA-N.

What is the canonical SMILES of N-acetyl-5-bromo-3-hydroxyindole?

The canonical SMILES is CC(=O)N1C=C(C2=C1C=CC(=C2)Br)O.

What is the CAS number of N-acetyl-5-bromo-3-hydroxyindole?

The CAS number is 114165-30-9.

What is the XLogP3-AA value of N-acetyl-5-bromo-3-hydroxyindole?

The XLogP3-AA value is 2.2.

How many hydrogen bond donor count does N-acetyl-5-bromo-3-hydroxyindole have?

N-acetyl-5-bromo-3-hydroxyindole has 1 hydrogen bond donor count.

How many hydrogen bond acceptor count does N-acetyl-5-bromo-3-hydroxyindole have?

N-acetyl-5-bromo-3-hydroxyindole has 2 hydrogen bond acceptor count.