1209458-22-9 Purity
---
If you have any other questions or need other size, please get a quote.
The molecular formula of the compound is C5H2BrF3N2OS.
The synonyms of the compound are N-(5-bromothiazol-4-yl)-2,2,2-trifluoroacetamide, 1211593-45-1, N-(5-bromo-1,3-thiazol-4-yl)-2,2,2-trifluoroacetamide, and Acetamide,N-(5-bromo-4-thiazolyl)-2,2,2-trifluoro-.
The molecular weight of the compound is 275.05 g/mol.
The IUPAC name of the compound is N-(5-bromo-1,3-thiazol-4-yl)-2,2,2-trifluoroacetamide.
The InChIKey of the compound is OBFXKHJBEFAQKX-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=NC(=C(S1)Br)NC(=O)C(F)(F)F.
The CAS number of the compound is 1211593-45-1.
The XLogP3-AA value of the compound is 2.6.
The compound has 1 hydrogen bond donor count.
The compound has 6 hydrogen bond acceptor counts.