13269-47-1 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C25H52N2O3.
The molecular weight of the compound is 428.7 g/mol.
The IUPAC name of the compound is acetic acid;N-[3-(dimethylamino)propyl]octadecanamide.
The InChI of the compound is InChI=1S/C23H48N2O.C2H4O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-23(26)24-21-19-22-25(2)3;1-2(3)4/h4-22H2,1-3H3,(H,24,26);1H3,(H,3,4).
The InChIKey of the compound is PKRDZHPWYDJXPO-UHFFFAOYSA-N.
The canonical SMILES of the compound is CCCCCCCCCCCCCCCCCC(=O)NCCCN(C)C.CC(=O)O.
The CAS number of the compound is 13282-70-7.
The compound has 2 hydrogen bond donor counts.
The compound has 4 hydrogen bond acceptor counts.
The compound has 20 rotatable bond counts.