N-(3-Bromo-2-pyridinyl)-acetamide

• CAS: 155444-28-3
• Catalog Number: ACM155444283
• Category: Bromine Series

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C7H7BrN2O.

What is the synonym of the compound?

The synonym of the compound is N-(3-bromopyridin-2-yl)acetamide.

What is the molecular weight of the compound?

The molecular weight of the compound is 215.05 g/mol.

When was the compound created?

The compound was created on July 8, 2005.

What is the IUPAC name of the compound?

The IUPAC name of the compound is N-(3-bromopyridin-2-yl)acetamide.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C7H7BrN2O/c1-5(11)10-7-6(8)3-2-4-9-7/h2-4H,1H3,(H,9,10,11).

What is the InChIKey of the compound?

The InChIKey of the compound is WTMIXVYAZYQKCK-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CC(=O)NC1=C(C=CC=N1)Br.

What is the CAS number of the compound?

The CAS number of the compound is 155444-28-3.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 1.1.