Methyl oleanonate

• CAS: 1721-58-0
• Catalog Number: ACM1721580
• Category: Steroidal Compounds
• Molecular Weight: 468.71
• Molecular Formula: C₃₁H₄₈O₃

Custom Q&A

What is the molecular formula of Methyl oleanonate?

The molecular formula of Methyl oleanonate is C31H48O3.

When was Methyl oleanonate created in PubChem?

Methyl oleanonate was created in PubChem on October 25, 2006.

What is the IUPAC Name of Methyl oleanonate?

The IUPAC Name of Methyl oleanonate is methyl (4aS,6aR,6aS,6bR,8aR,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylate.

What is the Canonical SMILES of Methyl oleanonate?

The Canonical SMILES of Methyl oleanonate is CC1(CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(=O)C5(C)C)C)C)C2C1)C)C(=O)OC)C.

How many hydrogen bond acceptor counts does Methyl oleanonate have?

Methyl oleanonate has 3 hydrogen bond acceptor counts.

What is the exact mass of Methyl oleanonate?

The exact mass of Methyl oleanonate is 468.36034539 g/mol.

How many defined atom stereocenter counts does Methyl oleanonate have?

Methyl oleanonate has 7 defined atom stereocenter counts.

What is the topological polar surface area of Methyl oleanonate?

The topological polar surface area of Methyl oleanonate is 43.4Ų.

What is the XLogP3-AA value of Methyl oleanonate?

The XLogP3-AA value of Methyl oleanonate is 7.5.

How many heavy atom counts does Methyl oleanonate have?

Methyl oleanonate has 34 heavy atom counts.