What is the molecular formula of Methyl 6-bromo-1H-indazole-3-carboxylate?
The molecular formula is C9H7BrN2O2.
What is the molecular weight of Methyl 6-bromo-1H-indazole-3-carboxylate?
The molecular weight is 255.07 g/mol.
What is the IUPAC name of Methyl 6-bromo-1H-indazole-3-carboxylate?
The IUPAC name is methyl 6-bromo-1H-indazole-3-carboxylate.
What is the InChI of Methyl 6-bromo-1H-indazole-3-carboxylate?
The InChI is InChI=1S/C9H7BrN2O2/c1-14-9(13)8-6-3-2-5(10)4-7(6)11-12-8/h2-4H,1H3,(H,11,12).
What is the InChIKey of Methyl 6-bromo-1H-indazole-3-carboxylate?
The InChIKey is FIPMZRPZSZXFGK-UHFFFAOYSA-N.
What is the Canonical SMILES of Methyl 6-bromo-1H-indazole-3-carboxylate?
The Canonical SMILES is COC(=O)C1=NNC2=C1C=CC(=C2)Br.
What is the CAS number of Methyl 6-bromo-1H-indazole-3-carboxylate?
The CAS number is 885278-42-2.
What is the European Community (EC) Number of Methyl 6-bromo-1H-indazole-3-carboxylate?
The European Community (EC) Number is 805-654-8.
What is the XLogP3-AA value of Methyl 6-bromo-1H-indazole-3-carboxylate?
The XLogP3-AA value is 2.4.
Is Methyl 6-bromo-1H-indazole-3-carboxylate a canonicalized compound?
Yes, Methyl 6-bromo-1H-indazole-3-carboxylate is a canonicalized compound.