Methyl 5-(trifluoromethyl)-1H-indole-2-carboxylate

• CAS: 1362860-89-6
• Catalog Number: ACM1362860896
• Category: Indoles
• Molecular Weight: 243.18
• Molecular Formula: C11H8F3NO2
• Synonyms: Methyl 5-trifluoromethyl-1H-indole-2-carboxylate

Custom Q&A

What is the molecular formula of Methyl 5-(trifluoromethyl)-1H-indole-2-carboxylate?

The molecular formula is C11H8F3NO2.

What is the molecular weight of Methyl 5-(trifluoromethyl)-1H-indole-2-carboxylate?

The molecular weight is 243.18 g/mol.

What is the IUPAC name of Methyl 5-(trifluoromethyl)-1H-indole-2-carboxylate?

The IUPAC name is methyl 5-(trifluoromethyl)-1H-indole-2-carboxylate.

What is the InChI of Methyl 5-(trifluoromethyl)-1H-indole-2-carboxylate?

The InChI is InChI=1S/C11H8F3NO2/c1-17-10(16)9-5-6-4-7(11(12,13)14)2-3-8(6)15-9/h2-5,15H,1H3.

What is the InChIKey of Methyl 5-(trifluoromethyl)-1H-indole-2-carboxylate?

The InChIKey is FXGFFFIBKZLKIY-UHFFFAOYSA-N.

What is the canonical SMILES of Methyl 5-(trifluoromethyl)-1H-indole-2-carboxylate?

The canonical SMILES is COC(=O)C1=CC2=C(N1)C=CC(=C2)C(F)(F)F.

What is the CAS number of Methyl 5-(trifluoromethyl)-1H-indole-2-carboxylate?

The CAS number is 1362860-89-6.

What is the European Community (EC) number of Methyl 5-(trifluoromethyl)-1H-indole-2-carboxylate?

The EC number is 815-918-4.

What is the XLogP3 value of Methyl 5-(trifluoromethyl)-1H-indole-2-carboxylate?

The XLogP3 value is 3.3.

Is Methyl 5-(trifluoromethyl)-1H-indole-2-carboxylate a canonicalized compound?

Yes, it is a canonicalized compound.