What is the molecular formula of methyl 3-(trifluoromethyl)pyrazine-2-carboxylate?
The molecular formula is C7H5F3N2O2.
What is the molecular weight of methyl 3-(trifluoromethyl)pyrazine-2-carboxylate?
The molecular weight is 206.12 g/mol.
What is the IUPAC name of methyl 3-(trifluoromethyl)pyrazine-2-carboxylate?
The IUPAC name is methyl 3-(trifluoromethyl)pyrazine-2-carboxylate.
What is the InChI of methyl 3-(trifluoromethyl)pyrazine-2-carboxylate?
The InChI is InChI=1S/C7H5F3N2O2/c1-14-6(13)4-5(7(8,9)10)12-3-2-11-4/h2-3H,1H3.
What is the InChIKey of methyl 3-(trifluoromethyl)pyrazine-2-carboxylate?
The InChIKey is AHAAJWNPVHTSHD-UHFFFAOYSA-N.
What is the canonical SMILES of methyl 3-(trifluoromethyl)pyrazine-2-carboxylate?
The canonical SMILES is COC(=O)C1=NC=CN=C1C(F)(F)F.
What is the XLogP3-AA value of methyl 3-(trifluoromethyl)pyrazine-2-carboxylate?
The XLogP3-AA value is 0.9.
How many hydrogen bond donor counts does methyl 3-(trifluoromethyl)pyrazine-2-carboxylate have?
It has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does methyl 3-(trifluoromethyl)pyrazine-2-carboxylate have?
It has 7 hydrogen bond acceptor counts.
How many rotatable bond counts does methyl 3-(trifluoromethyl)pyrazine-2-carboxylate have?
It has 2 rotatable bond counts.