methyl 3,5-dichloropyrazine-2-carboxylate

• CAS: 330786-09-9
• Catalog Number: ACM330786099
• Category: Pyrazines
• Molecular Weight: 207.0
• Molecular Formula: C6H4Cl2N2O2
• Appearance: Off-white powder

Custom Q&A

What is the molecular formula of methyl 3,5-dichloropyrazine-2-carboxylate?

The molecular formula is C6H4Cl2N2O2.

What is the molecular weight of methyl 3,5-dichloropyrazine-2-carboxylate?

The molecular weight is 207.01 g/mol.

What is the IUPAC name of methyl 3,5-dichloropyrazine-2-carboxylate?

The IUPAC name is methyl 3,5-dichloropyrazine-2-carboxylate.

What is the InChI of methyl 3,5-dichloropyrazine-2-carboxylate?

The InChI is InChI=1S/C6H4Cl2N2O2/c1-12-6(11)4-5(8)10-3(7)2-9-4/h2H,1H3.

What is the InChIKey of methyl 3,5-dichloropyrazine-2-carboxylate?

The InChIKey is VEDWLDKMRDJFNF-UHFFFAOYSA-N.

How many hydrogen bond donor counts does methyl 3,5-dichloropyrazine-2-carboxylate have?

It has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does methyl 3,5-dichloropyrazine-2-carboxylate have?

It has 4 hydrogen bond acceptor counts.

What is the exact mass of methyl 3,5-dichloropyrazine-2-carboxylate?

The exact mass is 205.9649828 g/mol.

How many rotatable bond counts does methyl 3,5-dichloropyrazine-2-carboxylate have?

It has 2 rotatable bond counts.

Is the compound canonicalized?

Yes, the compound is canonicalized.