Methyl 3,5-dibromo-4-pyridinecarboxylate

• CAS: 1214375-07-1
• Catalog Number: ACM1214375071
• Category: Pyridines
• Molecular Weight: 294.9
• Molecular Formula: C7H5Br2NO2
• Synonyms: Methyl 3,5-dibromoisonicotinate

Custom Q&A

What is the molecular formula of Methyl 3,5-dibromo-4-pyridinecarboxylate?

The molecular formula of Methyl 3,5-dibromo-4-pyridinecarboxylate is C7H5Br2NO2.

What are the synonyms for Methyl 3,5-dibromo-4-pyridinecarboxylate?

The synonyms for Methyl 3,5-dibromo-4-pyridinecarboxylate include Methyl 3,5-dibromoisonicotinate and methyl 3,5-dibromopyridine-4-carboxylate.

What is the molecular weight of Methyl 3,5-dibromo-4-pyridinecarboxylate?

The molecular weight of Methyl 3,5-dibromo-4-pyridinecarboxylate is 294.93 g/mol.

What is the IUPAC name of Methyl 3,5-dibromo-4-pyridinecarboxylate?

The IUPAC name of Methyl 3,5-dibromo-4-pyridinecarboxylate is methyl 3,5-dibromopyridine-4-carboxylate.

What is the InChI of Methyl 3,5-dibromo-4-pyridinecarboxylate?

The InChI of Methyl 3,5-dibromo-4-pyridinecarboxylate is InChI=1S/C7H5Br2NO2/c1-12-7(11)6-4(8)2-10-3-5(6)9/h2-3H,1H3.

What is the InChIKey of Methyl 3,5-dibromo-4-pyridinecarboxylate?

The InChIKey of Methyl 3,5-dibromo-4-pyridinecarboxylate is OTAPIZRUTJEJPF-UHFFFAOYSA-N.

What is the canonical SMILES of Methyl 3,5-dibromo-4-pyridinecarboxylate?

The canonical SMILES of Methyl 3,5-dibromo-4-pyridinecarboxylate is COC(=O)C1=C(C=NC=C1Br)Br.

What is the XLogP3-AA value of Methyl 3,5-dibromo-4-pyridinecarboxylate?

The XLogP3-AA value of Methyl 3,5-dibromo-4-pyridinecarboxylate is 2.1.

How many hydrogen bond donor counts does Methyl 3,5-dibromo-4-pyridinecarboxylate have?

Methyl 3,5-dibromo-4-pyridinecarboxylate has 0 hydrogen bond donor count.

How many rotatable bond counts does Methyl 3,5-dibromo-4-pyridinecarboxylate have?

Methyl 3,5-dibromo-4-pyridinecarboxylate has 2 rotatable bond counts.