Methyl 3-(4-methoxyphenyl)oxirane-2-carboxylate

• CAS: 42245-42-1
• Catalog Number: ACM42245421
• Category: Polymer/Macromolecule
• Molecular Weight: 208.21
• Molecular Formula: C₁₁H₁₂O₄
• Synonyms: METHYL TRANS-3-(4-METHOXYPHENYL)GLYCIDATE;3-(4-methoxyphenyl)-oxiranecarboxylicacimethylester;3-(-methoxyphenyl)glycidicacidmethylester;methyl 3-(p-methoxyphenyl)oxirane-2-carboxylate;Oxiranecarboxylic acid, 3-(4-methoxyphenyl)-, methyl ester;TRANS-2,3-EP

Custom Q&A

What is the molecular formula of Methyl 3-(4-methoxyphenyl)oxirane-2-carboxylate?

The molecular formula is C11H12O4.

What is the molecular weight of Methyl 3-(4-methoxyphenyl)oxirane-2-carboxylate?

The molecular weight is 208.21 g/mol.

What is the IUPAC name of Methyl 3-(4-methoxyphenyl)oxirane-2-carboxylate?

The IUPAC name is methyl 3-(4-methoxyphenyl)oxirane-2-carboxylate.

What is the InChI of Methyl 3-(4-methoxyphenyl)oxirane-2-carboxylate?

The InChI is InChI=1S/C11H12O4/c1-13-8-5-3-7(4-6-8)9-10(15-9)11(12)14-2/h3-6,9-10H,1-2H3.

What is the InChIKey of Methyl 3-(4-methoxyphenyl)oxirane-2-carboxylate?

The InChIKey is CVZUMGUZDAWOGA-UHFFFAOYSA-N.

What is the canonical SMILES of Methyl 3-(4-methoxyphenyl)oxirane-2-carboxylate?

The canonical SMILES is COC1=CC=C(C=C1)C2C(O2)C(=O)OC.

What is the CAS number of Methyl 3-(4-methoxyphenyl)oxirane-2-carboxylate?

The CAS number is 42245-42-1.

What is the XLogP3-AA value of Methyl 3-(4-methoxyphenyl)oxirane-2-carboxylate?

The XLogP3-AA value is 1.3.

How many hydrogen bond donor count does Methyl 3-(4-methoxyphenyl)oxirane-2-carboxylate have?

Methyl 3-(4-methoxyphenyl)oxirane-2-carboxylate has 0 hydrogen bond donor count.

How many hydrogen bond acceptor count does Methyl 3-(4-methoxyphenyl)oxirane-2-carboxylate have?

Methyl 3-(4-methoxyphenyl)oxirane-2-carboxylate has 4 hydrogen bond acceptor count.