Methyl 1,2,3,4-tetrahydroquinoline-6-carboxylate

• CAS: 177478-49-8
• Catalog Number: ACM177478498-1
• Category: Quinolines
• Molecular Weight: 191.23
• Molecular Formula: C11H13NO2
• Melting Point: 73-76 °C
• Appearance: White to Tan Solid, Powder, Crystals and/or Chunks

Custom Q&A

What is the molecular formula of Methyl 1,2,3,4-tetrahydroquinoline-6-carboxylate?

The molecular formula is C11H13NO2.

What is the molecular weight of Methyl 1,2,3,4-tetrahydroquinoline-6-carboxylate?

The molecular weight is 191.23 g/mol.

What is the IUPAC name of Methyl 1,2,3,4-tetrahydroquinoline-6-carboxylate?

The IUPAC name is methyl 1,2,3,4-tetrahydroquinoline-6-carboxylate.

What is the InChI of Methyl 1,2,3,4-tetrahydroquinoline-6-carboxylate?

The InChI is InChI=1S/C11H13NO2/c1-14-11(13)9-4-5-10-8(7-9)3-2-6-12-10/h4-5,7,12H,2-3,6H2,1H3.

What is the InChIKey of Methyl 1,2,3,4-tetrahydroquinoline-6-carboxylate?

The InChIKey is PPSPOJUGGLXCIV-UHFFFAOYSA-N.

How many hydrogen bond donor counts does Methyl 1,2,3,4-tetrahydroquinoline-6-carboxylate have?

It has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does Methyl 1,2,3,4-tetrahydroquinoline-6-carboxylate have?

It has 3 hydrogen bond acceptor counts.

What is the topological polar surface area of Methyl 1,2,3,4-tetrahydroquinoline-6-carboxylate?

The topological polar surface area is 38.3 Ų.

Does Methyl 1,2,3,4-tetrahydroquinoline-6-carboxylate have any defined atom stereocenters?

No, it has 0 defined atom stereocenters.

Is the compound canonicalized?

Yes, the compound is canonicalized.