Methanamine,N-(3,3-dimethylbicyclo[2.2.1]hept-2-ylidene)-(9ci)

• CAS: 1312-74-8
• Catalog Number: ACM1312748
• Category: Other Products
• Molecular Weight: 151.24868
• Molecular Formula: C₁₀H₁₇N
• Synonyms: Methanamine, N-(3,3-dimethylbicyclo[2.2.1]hept-2-ylidene)- (9CI)

Custom Q&A

What is the molecular formula of Methanamine, N-(3,3-dimethylbicyclo[2.2.1]hept-2-ylidene)-(9ci)?

The molecular formula is C10H17N.

What is the molecular weight of Methanamine, N-(3,3-dimethylbicyclo[2.2.1]hept-2-ylidene)-(9ci)?

The molecular weight is 151.25 g/mol.

What is the IUPAC name of Methanamine, N-(3,3-dimethylbicyclo[2.2.1]hept-2-ylidene)-(9ci)?

The IUPAC name is N,3,3-trimethylbicyclo[2.2.1]heptan-2-imine.

What is the InChI of Methanamine, N-(3,3-dimethylbicyclo[2.2.1]hept-2-ylidene)-(9ci)?

The InChI is InChI=1S/C10H17N/c1-10(2)8-5-4-7(6-8)9(10)11-3/h7-8H,4-6H2,1-3H3.

What is the InChIKey of Methanamine, N-(3,3-dimethylbicyclo[2.2.1]hept-2-ylidene)-(9ci)?

The InChIKey is PDAOQWRAHRESSJ-UHFFFAOYSA-N.

What is the canonical SMILES of Methanamine, N-(3,3-dimethylbicyclo[2.2.1]hept-2-ylidene)-(9ci)?

The canonical SMILES is CC1(C2CCC(C2)C1=NC).

What is the XLogP3-AA value of Methanamine, N-(3,3-dimethylbicyclo[2.2.1]hept-2-ylidene)-(9ci)?

The XLogP3-AA value is 2.1.

How many hydrogen bond donor counts does Methanamine, N-(3,3-dimethylbicyclo[2.2.1]hept-2-ylidene)-(9ci) have?

It has 0 hydrogen bond donor count.

How many hydrogen bond acceptor counts does Methanamine, N-(3,3-dimethylbicyclo[2.2.1]hept-2-ylidene)-(9ci) have?

It has 1 hydrogen bond acceptor count.

How many rotatable bond counts does Methanamine, N-(3,3-dimethylbicyclo[2.2.1]hept-2-ylidene)-(9ci) have?

It has 0 rotatable bond count.