Methacryloxymethyltrimethylgermane

• CAS: 125668-59-9
• Catalog Number: ACM125668599
• Category: Organic Germanium
• Molecular Formula: C₈H₁₆GeO₂
• Density: 1.13

Custom Q&A

What is the molecular formula of Methacryloxymethyltrimethylgermane?

The molecular formula is C8H16GeO2.

When was Methacryloxymethyltrimethylgermane created?

It was created on December 6, 2007.

What is the IUPAC name of Methacryloxymethyltrimethylgermane?

The IUPAC name is trimethylgermylmethyl 2-methylprop-2-enoate.

What is the InChI of Methacryloxymethyltrimethylgermane?

The InChI is InChI=1S/C8H16GeO2/c1-7(2)8(10)11-6-9(3,4)5/h1,6H2,2-5H3.

What is the InChIKey of Methacryloxymethyltrimethylgermane?

The InChIKey is VWYKMPSIISPSAM-UHFFFAOYSA-N.

What is the canonical SMILES of Methacryloxymethyltrimethylgermane?

The canonical SMILES is CC(=C)C(=O)OC[Ge](C)(C)C.

What is the molecular weight of Methacryloxymethyltrimethylgermane?

The molecular weight is 216.84 g/mol.

How many hydrogen bond acceptor counts does Methacryloxymethyltrimethylgermane have?

It has 2 hydrogen bond acceptor counts.

What is the exact mass of Methacryloxymethyltrimethylgermane?

The exact mass is 218.0362075 g/mol.

Is the compound canonicalized?

Yes, the compound is canonicalized.