Meso-2,3-dibromosuccinic acid

• CAS: 526-78-3
• Catalog Number: ACM526783
• Category: Polymer/Macromolecule
• Molecular Weight: 275.88
• Molecular Formula: C₄H₄Br₂O₄
• Synonyms: 2,3-dibromo-butanedioicaci;2,3-Dibromobutanedioicacid;2,3-dibromo-Butanedioicacid;Butanedioicacid,2,3-dibromo-;sym-Dibromosucci-nicacid;ALPHA,BETA-DIBROMOSUCCINIC ACID;2,3-DIBROMOSUCCINIC ACID;2,3-Dibromosucinic Acid

Custom Q&A

What is the molecular formula of Meso-2,3-dibromosuccinic acid?

The molecular formula of Meso-2,3-dibromosuccinic acid is C4H4Br2O4.

What is the molecular weight of Meso-2,3-dibromosuccinic acid?

The molecular weight of Meso-2,3-dibromosuccinic acid is 275.88 g/mol.

What is the IUPAC name of Meso-2,3-dibromosuccinic acid?

The IUPAC name of Meso-2,3-dibromosuccinic acid is (2S,3R)-2,3-dibromobutanedioic acid.

What is the InChI of Meso-2,3-dibromosuccinic acid?

The InChI of Meso-2,3-dibromosuccinic acid is InChI=1S/C4H4Br2O4/c5-1(3(7)8)2(6)4(9)10/h1-2H,(H,7,8)(H,9,10)/t1-,2+.

What is the InChIKey of Meso-2,3-dibromosuccinic acid?

The InChIKey of Meso-2,3-dibromosuccinic acid is FJWGRXKOBIVTFA-XIXRPRMCSA-N.

What is the canonical SMILES of Meso-2,3-dibromosuccinic acid?

The canonical SMILES of Meso-2,3-dibromosuccinic acid is C(C(C(=O)O)Br)(C(=O)O)Br.

How many hydrogen bond donor counts does Meso-2,3-dibromosuccinic acid have?

Meso-2,3-dibromosuccinic acid has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does Meso-2,3-dibromosuccinic acid have?

Meso-2,3-dibromosuccinic acid has 4 hydrogen bond acceptor counts.

How many rotatable bond counts does Meso-2,3-dibromosuccinic acid have?

Meso-2,3-dibromosuccinic acid has 3 rotatable bond counts.

What is the topological polar surface area of Meso-2,3-dibromosuccinic acid?

The topological polar surface area of Meso-2,3-dibromosuccinic acid is 74.6Ų.