What is the molecular formula of L-Homophenylalanine ethyl ester hydrochloride?
The molecular formula is C12H18ClNO2.
What is the molecular weight of L-Homophenylalanine ethyl ester hydrochloride?
The molecular weight is 243.73 g/mol.
What are some synonyms for L-Homophenylalanine ethyl ester hydrochloride?
Some synonyms include Ethyl (S)-2-amino-4-phenylbutanoate hydrochloride and H-HoPhe-OEt.HCl.
When was L-Homophenylalanine ethyl ester hydrochloride created in PubChem?
It was created on July 19, 2005.
What is the IUPAC name of L-Homophenylalanine ethyl ester hydrochloride?
The IUPAC name is ethyl (2S)-2-amino-4-phenylbutanoate;hydrochloride.
What is the InChIKey of L-Homophenylalanine ethyl ester hydrochloride?
The InChIKey is PTFKZMFFSIYCOV-MERQFXBCSA-N.
What is the canonical SMILES of L-Homophenylalanine ethyl ester hydrochloride?
The canonical SMILES is CCOC(=O)C(CCC1=CC=CC=C1)N.Cl.
What is the CAS number of L-Homophenylalanine ethyl ester hydrochloride?
The CAS number is 90891-21-7.
How many hydrogen bond donor counts does L-Homophenylalanine ethyl ester hydrochloride have?
It has 2 hydrogen bond donor counts.
Is the compound is canonicalized according to PubChem?
Yes, the compound is canonicalized according to PubChem.