What is the molecular formula of L-Ethyl 1,2,3,4-tetrahydroisoquinoline-3-carboxylate hydrochloride?
The molecular formula is C12H16ClNO2.
What is the molecular weight of L-Ethyl 1,2,3,4-tetrahydroisoquinoline-3-carboxylate hydrochloride?
The molecular weight is 241.71 g/mol.
What is the IUPAC name of L-Ethyl 1,2,3,4-tetrahydroisoquinoline-3-carboxylate hydrochloride?
The IUPAC name is ethyl (3S)-1,2,3,4-tetrahydroisoquinoline-3-carboxylate;hydrochloride.
What is the InChI of L-Ethyl 1,2,3,4-tetrahydroisoquinoline-3-carboxylate hydrochloride?
The InChI is InChI=1S/C12H15NO2.ClH/c1-2-15-12(14)11-7-9-5-3-4-6-10(9)8-13-11;/h3-6,11,13H,2,7-8H2,1H3;1H/t11-;/m0./s1.
What is the InChIKey of L-Ethyl 1,2,3,4-tetrahydroisoquinoline-3-carboxylate hydrochloride?
The InChIKey is GKLWWGAFDIKVQY-MERQFXBCSA-N.
What is the canonical SMILES of L-Ethyl 1,2,3,4-tetrahydroisoquinoline-3-carboxylate hydrochloride?
The canonical SMILES is CCOC(=O)C1CC2=CC=CC=C2CN1.Cl.
What is the CAS number of L-Ethyl 1,2,3,4-tetrahydroisoquinoline-3-carboxylate hydrochloride?
The CAS number is 15912-56-8.
How many hydrogen bond donor counts does L-Ethyl 1,2,3,4-tetrahydroisoquinoline-3-carboxylate hydrochloride have?
It has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does L-Ethyl 1,2,3,4-tetrahydroisoquinoline-3-carboxylate hydrochloride have?
It has 3 hydrogen bond acceptor counts.