Hexafluorobisphenol a

• CAS: 1478-61-1
• Catalog Number: ACM1478611
• Category: Polymer/Macromolecule
• Molecular Weight: 336.23
• Molecular Formula: C₁₅H₁₀F₆O₂
• Synonyms: 2,2-bis(4-hydroxy-phenyl)-1,1,1,3,3,3-hexafluoropropane;3,3'-(hexafluoroisopropylidene)diphenol;4,4'-(2,2,2-trifluoro-1-(trifluoromethyl)ethylidene)bis-pheno;4,4'-(bis(trifluoromethyl)methylene)di-Phenol;4,4'-(trifluoro-1-(trifluoromethyl)ethylidene)di-ph

Custom Q&A

What is the molecular formula of Hexafluorobisphenol a?

The molecular formula of Hexafluorobisphenol a is C15H10F6O2.

What is the molecular weight of Hexafluorobisphenol a?

The molecular weight of Hexafluorobisphenol a is 336.23 g/mol.

What is the IUPAC name of Hexafluorobisphenol a?

The IUPAC name of Hexafluorobisphenol a is 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenol.

What is the InChIKey of Hexafluorobisphenol a?

The InChIKey of Hexafluorobisphenol a is ZFVMWEVVKGLCIJ-UHFFFAOYSA-N.

What is the canonical SMILES representation of Hexafluorobisphenol a?

The canonical SMILES representation of Hexafluorobisphenol a is C1=CC(=CC=C1C(C2=CC=C(C=C2)O)(C(F)(F)F)C(F)(F)F)O.

What is the CAS number of Hexafluorobisphenol a?

The CAS number of Hexafluorobisphenol a is 1478-61-1.

What is the EC number of Hexafluorobisphenol a?

The EC number of Hexafluorobisphenol a is 216-036-7.

What is the XLogP3 value of Hexafluorobisphenol a?

The XLogP3 value of Hexafluorobisphenol a is 4.5.

How many hydrogen bond donor counts does Hexafluorobisphenol a have?

Hexafluorobisphenol a has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does Hexafluorobisphenol a have?

Hexafluorobisphenol a has 8 hydrogen bond acceptor counts.