Gadoteric acid

• CAS: 72573-82-1
• Catalog Number: ACM72573821
• Category: Other Products
• Molecular Weight: 558.65
• Molecular Formula: C₁₆H₂₅GdN₄O₈
• Synonyms: Gadoteric acid;Gadoteric;Gadolinium 2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetraazacyclododec-1-yl]acetic acid;Gadolinate(1-),[1,4,7,10-tetraazacyclododecane-1,4,7,10-tetraacetato(4-)-kN1,kN4,kN7,kN10,kO1,kO4,kO7,kO10]-, hydrogen (1:1)

Custom Q&A

What is the molecular formula of gadoteric acid?

The molecular formula of gadoteric acid is C16H25GdN4O8.

What is the molecular weight of gadoteric acid?

The molecular weight of gadoteric acid is 558.6 g/mol.

What is the IUPAC name of gadoteric acid?

The IUPAC name of gadoteric acid is 2-[4,7-bis(carboxylatomethyl)-10-(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate; gadolinium(3+).

How does gadoteric acid function as an MRI contrast agent?

Gadoteric acid enhances the relaxation rates of water protons in its vicinity, leading to an increase in signal intensity of tissues, which allows for imaging of blood vessels and inflamed or diseased tissue.

What is the InChIKey of gadoteric acid?

The InChIKey of gadoteric acid is GFSTXYOTEVLASN-UHFFFAOYSA-K.

What is the Canonical SMILES of gadoteric acid?

The Canonical SMILES of gadoteric acid is C1CN(CCN(CCN(CCN1CC(=O)O)CC(=O)[O-])CC(=O)[O-])CC(=O)[O-].[Gd+3].

What is the CAS number of gadoteric acid?

The CAS number of gadoteric acid is 72573-82-1.

What is the hydrogen bond donor count of gadoteric acid?

The hydrogen bond donor count of gadoteric acid is 1.

How many hydrogen bond acceptors are present in gadoteric acid?

Gadoteric acid has 12 hydrogen bond acceptors.

What is the topological polar surface area of gadoteric acid?

The topological polar surface area of gadoteric acid is 171 Å2.