Fmoc-s-trityl-L-penicillamine

• CAS: 201531-88-6
• Catalog Number: ACM201531886
• Category: Other Products
• Molecular Weight: 613.76
• Molecular Formula: C₃₉H₃₅NO₄S
• Synonyms: FMOC-PEN(TRT)-OH;FMOC-PENICILLAMINE(TRT)-OH;FMOC-S-TRITYL-BETA,BETA-DIMETHYL-L-CYS-OH;FMOC-S-TRITYL-L-PENICILLAMINE;FMOC-CYSME 2(TRT)-OH;FMOC-L-PEN(TRT)-OH;FMOC-BETA,BETA-DIMETHYL-CYS(TRT)-OH;N-ALPHA-(9-FLUORENYLMETHOXYCARBONYL)-S-TRITYL-3,3-DIMETHYL-L-CYSTEINE

Custom Q&A

What is the molecular formula of Fmoc-s-trityl-L-penicillamine?

The molecular formula of Fmoc-s-trityl-L-penicillamine is C39H35NO4S.

What are some synonyms for Fmoc-s-trityl-L-penicillamine?

Some synonyms for Fmoc-s-trityl-L-penicillamine are Fmoc-Pen(Trt)-OH, 201531-88-6, and (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-methyl-3-(tritylthio)butanoic acid.

What is the molecular weight of Fmoc-s-trityl-L-penicillamine?

The molecular weight of Fmoc-s-trityl-L-penicillamine is 613.8 g/mol.

What is the IUPAC name of Fmoc-s-trityl-L-penicillamine?

The IUPAC name of Fmoc-s-trityl-L-penicillamine is (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methyl-3-tritylsulfanylbutanoic acid.

What is the InChIKey of Fmoc-s-trityl-L-penicillamine?

The InChIKey of Fmoc-s-trityl-L-penicillamine is XSGMGAINOILNJR-PGUFJCEWSA-N.

What is the Canonical SMILES of Fmoc-s-trityl-L-penicillamine?

The Canonical SMILES of Fmoc-s-trityl-L-penicillamine is CC(C)(C(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)SC(C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6.

What is the CAS number of Fmoc-s-trityl-L-penicillamine?

The CAS number of Fmoc-s-trityl-L-penicillamine is 201531-88-6.

How many hydrogen bond donor counts are there in Fmoc-s-trityl-L-penicillamine?

There are 2 hydrogen bond donor counts in Fmoc-s-trityl-L-penicillamine.

What is the XLogP3-AA value of Fmoc-s-trityl-L-penicillamine?

The XLogP3-AA value of Fmoc-s-trityl-L-penicillamine is 8.6.

What is the topological polar surface area of Fmoc-s-trityl-L-penicillamine?

The topological polar surface area of Fmoc-s-trityl-L-penicillamine is 101.2.