Finafloxacin hydrochloride

CAS

209342-41-6

Catalog Number

ACM209342416

Category

Other Products

Molecular Weight

434.8486032

Molecular Formula

C₂₀H₂₀ClFN₄O₄

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

Finafloxacin Hydrochloride;3-Quinolinecarboxylic acid, 8-cyano-1-cyclopropyl-6-fluoro-7-[(4aS,7aS)-hexahydropyrrolo[3,4-b]-1,4-oxazin-6(2H)-yl]-1,4-dihydro-4-oxo-, Monohydrochloride (9CI);8-Cyano-1-cyclopropyl-6-fluoro-7-[(4aS,7aS)-hexahydropyrrolo[3,4-b]-1,4-oxazin-6(2H)-yl]-1,4-dihydro-4-oxo-3-quinolinecarboxylic Acid Hydrochloride;8-cyano-1-cyclopropyl-6-fluoro-7-((4aS,7aS)-hexahydropyrrolo[3,4-b][1,4]oxazin-6(2H)-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid hydrochloride;8-Cyano-1-cyclopropyl-6-fluoro-7-[(4aS,7aS)-hexahydropyrrolo[3,4-b]-1,4-oxazin-6(2H)-yl]-1,4-dihydro-4-oxo-3-quinolinecarboxylic acid monohydrochloride

What is the molecular formula of Finafloxacin hydrochloride?

The molecular formula of Finafloxacin hydrochloride is C20H20ClFN4O4.

What is the molecular weight of Finafloxacin hydrochloride?

The molecular weight of Finafloxacin hydrochloride is 434.8 g/mol.

What are some synonyms for Finafloxacin hydrochloride?

Some synonyms for Finafloxacin hydrochloride include finafloxacin HCl and BAY-35-3377.

When was Finafloxacin hydrochloride created and last modified?

Finafloxacin hydrochloride was created on 2006-10-26 and last modified on 2023-12-30.

What is the IUPAC name of Finafloxacin hydrochloride?

The IUPAC name of Finafloxacin hydrochloride is 7-[(4aS,7aS)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-8-cyano-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid;hydrochloride.

What is the Canonical SMILES of Finafloxacin hydrochloride?

The Canonical SMILES of Finafloxacin hydrochloride is C1CC1N2C=C(C(=O)C3=CC(=C(C(=C32)C#N)N4CC5C(C4)OCCN5)F)C(=O)O.Cl.

What is the CAS number of Finafloxacin hydrochloride?

The CAS number of Finafloxacin hydrochloride is 209342-41-6.

How many hydrogen bond donor counts are there in Finafloxacin hydrochloride?

Finafloxacin hydrochloride has 3 hydrogen bond donor counts.

What is the topological polar surface area of Finafloxacin hydrochloride?

The topological polar surface area of Finafloxacin hydrochloride is 106 ².

How many defined atom stereocenter counts are there in Finafloxacin hydrochloride?

Finafloxacin hydrochloride has 2 defined atom stereocenter counts.

Recommended Products