ethyl imidazo[1,5-a]pyrazine-1-carboxylate

• CAS: 1377584-27-4
• Catalog Number: ACM1377584274
• Category: Pyrazines
• Molecular Weight: 192.1
• Molecular Formula: C9H9N3O2
• Appearance: Yellows powder

Custom Q&A

What is the molecular formula of ethyl imidazo[1,5-a]pyrazine-1-carboxylate?

The molecular formula is C9H9N3O2.

What are the synonyms for ethyl imidazo[1,5-a]pyrazine-1-carboxylate?

The synonyms include ethyl imidazo[1,5-a]pyrazine-1-carboxylate, 1377584-27-4, MFCD28128621, Imidazo[1,5-a]pyrazine-1-carboxylic acid, ethyl ester, CFC58427.

What is the molecular weight of ethyl imidazo[1,5-a]pyrazine-1-carboxylate?

The molecular weight is 191.19 g/mol.

What is the IUPAC name of ethyl imidazo[1,5-a]pyrazine-1-carboxylate?

The IUPAC name is ethyl imidazo[1,5-a]pyrazine-1-carboxylate.

What is the InChI of ethyl imidazo[1,5-a]pyrazine-1-carboxylate?

The InChI is InChI=1S/C9H9N3O2/c1-2-14-9(13)8-7-5-10-3-4-12(7)6-11-8/h3-6H,2H2,1H3.

What is the InChIKey of ethyl imidazo[1,5-a]pyrazine-1-carboxylate?

The InChIKey is SBTSHTIBWNYTDN-UHFFFAOYSA-N.

What is the canonical SMILES of ethyl imidazo[1,5-a]pyrazine-1-carboxylate?

The canonical SMILES is CCOC(=O)C1=C2C=NC=CN2C=N1.

What is the XLogP3-AA value of ethyl imidazo[1,5-a]pyrazine-1-carboxylate?

The XLogP3-AA value is 1.3.

How many hydrogen bond donor counts does ethyl imidazo[1,5-a]pyrazine-1-carboxylate have?

It has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does ethyl imidazo[1,5-a]pyrazine-1-carboxylate have?

It has 4 hydrogen bond acceptor counts.