What is the molecular formula of Ethyl 4-[[(methylphenylamino)methylene]amino]benzoate?
The molecular formula is C17H18N2O2.
What is the molecular weight of Ethyl 4-[[(methylphenylamino)methylene]amino]benzoate?
The molecular weight is 282.34 g/mol.
What is the IUPAC name of Ethyl 4-[[(methylphenylamino)methylene]amino]benzoate?
The IUPAC name is ethyl 4-[(N-methylanilino)methylideneamino]benzoate.
What is the InChI of Ethyl 4-[[(methylphenylamino)methylene]amino]benzoate?
The InChI is InChI=1S/C17H18N2O2/c1-3-21-17(20)14-9-11-15(12-10-14)18-13-19(2)16-7-5-4-6-8-16/h4-13H,3H2,1-2H3.
What is the InChIKey of Ethyl 4-[[(methylphenylamino)methylene]amino]benzoate?
The InChIKey is GNGYPJUKIKDJQT-UHFFFAOYSA-N.
What is the canonical SMILES of Ethyl 4-[[(methylphenylamino)methylene]amino]benzoate?
The canonical SMILES is CCOC(=O)C1=CC=C(C=C1)N=CN(C)C2=CC=CC=C2.
What is the CAS number of Ethyl 4-[[(methylphenylamino)methylene]amino]benzoate?
The CAS number is 57834-33-0.
What is the XLogP3-AA value of Ethyl 4-[[(methylphenylamino)methylene]amino]benzoate?
The XLogP3-AA value is 3.4.
How many hydrogen bond donors does Ethyl 4-[[(methylphenylamino)methylene]amino]benzoate have?
It has 0 hydrogen bond donors.
How many hydrogen bond acceptors does Ethyl 4-[[(methylphenylamino)methylene]amino]benzoate have?
It has 3 hydrogen bond acceptors.