Ethyl 4-methoxy-3-methylbenzoylformate

• Catalog Number: ACMA00002271
• Category: Ethers
• Molecular Weight: 222.24
• Molecular Formula: C₁₂H₁₄O₃
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of ethyl 4-methoxy-3-methylbenzoylformate?

The molecular formula is C12H14O4.

What is the molecular weight of ethyl 4-methoxy-3-methylbenzoylformate?

The molecular weight is 222.24 g/mol.

What is the IUPAC name of ethyl 4-methoxy-3-methylbenzoylformate?

The IUPAC name is ethyl 2-(4-methoxy-3-methylphenyl)-2-oxoacetate.

What is the InChI of ethyl 4-methoxy-3-methylbenzoylformate?

The InChI is InChI=1S/C12H14O4/c1-4-16-12(14)11(13)9-5-6-10(15-3)8(2)7-9/h5-7H,4H2,1-3H3.

What is the InChIKey of ethyl 4-methoxy-3-methylbenzoylformate?

The InChIKey is RRLPISAPBOSKFR-UHFFFAOYSA-N.

What is the canonical SMILES of ethyl 4-methoxy-3-methylbenzoylformate?

The canonical SMILES is CCOC(=O)C(=O)C1=CC(=C(C=C1)OC)C.

What is the CAS number of ethyl 4-methoxy-3-methylbenzoylformate?

The CAS number is 859979-73-0.

What is the XLogP3-AA value of ethyl 4-methoxy-3-methylbenzoylformate?

The XLogP3-AA value is 2.4.

How many hydrogen bond donor counts does ethyl 4-methoxy-3-methylbenzoylformate have?

It has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does ethyl 4-methoxy-3-methylbenzoylformate have?

It has 4 hydrogen bond acceptor counts.