Ethyl 4-Bromophenylacetate

• CAS: 14062-25-0
• Catalog Number: ACM14062250
• Category: Bromine Series

Custom Q&A

What is the molecular formula of Ethyl 4-Bromophenylacetate?

The molecular formula of Ethyl 4-Bromophenylacetate is C10H11BrO2.

What is the molecular weight of Ethyl 4-Bromophenylacetate?

The molecular weight of Ethyl 4-Bromophenylacetate is 243.10 g/mol.

What is the IUPAC name of Ethyl 4-Bromophenylacetate?

The IUPAC name of Ethyl 4-Bromophenylacetate is ethyl 2-(4-bromophenyl)acetate.

What is the InChI of Ethyl 4-Bromophenylacetate?

The InChI of Ethyl 4-Bromophenylacetate is InChI=1S/C10H11BrO2/c1-2-13-10(12)7-8-3-5-9(11)6-4-8/h3-6H,2,7H2,1H3.

What is the InChIKey of Ethyl 4-Bromophenylacetate?

The InChIKey of Ethyl 4-Bromophenylacetate is ZFDCWHPNBWPPHG-UHFFFAOYSA-N.

What is the canonical SMILES of Ethyl 4-Bromophenylacetate?

The canonical SMILES of Ethyl 4-Bromophenylacetate is CCOC(=O)CC1=CC=C(C=C1)Br.

What is the CAS number of Ethyl 4-Bromophenylacetate?

The CAS number of Ethyl 4-Bromophenylacetate is 14062-25-0.

What is the European Community (EC) Number of Ethyl 4-Bromophenylacetate?

The European Community (EC) Number of Ethyl 4-Bromophenylacetate is 628-950-7.

What is the XLogP3 value of Ethyl 4-Bromophenylacetate?

The XLogP3 value of Ethyl 4-Bromophenylacetate is 3.

Is Ethyl 4-Bromophenylacetate a canonicalized compound?

Yes, Ethyl 4-Bromophenylacetate is a canonicalized compound.