Ethyl 3-ethoxy-3-iminopropionate hydrochloride

• CAS: 2318-25-4
• Catalog Number: ACM2318254
• Category: Coupler
• Molecular Weight: 195.64
• Molecular Formula: C₇H₁₃NO₃.HCl

Custom Q&A

What is the molecular formula of Ethyl 3-ethoxy-3-iminopropionate hydrochloride?

The molecular formula is C7H14ClNO3.

What are some synonyms for Ethyl 3-ethoxy-3-iminopropionate hydrochloride?

Some synonyms include ethyl 3-ethoxy-3-iminopropanoate hydrochloride and Ethyl carbethoxyacetimidate hydrochloride.

When was Ethyl 3-ethoxy-3-iminopropionate hydrochloride created and last modified?

It was created on July 19, 2005, and last modified on December 23, 2023.

What is the InChIKey of Ethyl 3-ethoxy-3-iminopropionate hydrochloride?

The InChIKey is HYMXUYQKXCHWDC-UHFFFAOYSA-N.

What is the Canonical SMILES of Ethyl 3-ethoxy-3-iminopropionate hydrochloride?

The Canonical SMILES is CCOC(=N)CC(=O)OCC.Cl.

What is the molecular weight of Ethyl 3-ethoxy-3-iminopropionate hydrochloride?

The molecular weight is 195.64 g/mol.

What is the hydrogen bond donor count of Ethyl 3-ethoxy-3-iminopropionate hydrochloride?

The hydrogen bond donor count is 2.

What is the exact mass of Ethyl 3-ethoxy-3-iminopropionate hydrochloride?

The exact mass is 195.0662210 g/mol.

How many rotatable bond counts does Ethyl 3-ethoxy-3-iminopropionate hydrochloride have?

It has 6 rotatable bond counts.

What is the topological polar surface area of Ethyl 3-ethoxy-3-iminopropionate hydrochloride?

The topological polar surface area is 59.4 Ų.

How is the IUPAC name of Ethyl 3-ethoxy-3-iminopropionate hydrochloride computed?

It is computed as ethyl 3-ethoxy-3-iminopropanoate; hydrochloride.

What is the InChI of Ethyl 3-ethoxy-3-iminopropionate hydrochloride?

The InChI is InChI=1S/C7H13NO3.ClH/c1-3-10-6(8)5-7(9)11-4-2;/h8H,3-5H2,1-2H3;1H.

How many Hydrogen Bond Donor Count does Ethyl 3-ethoxy-3-iminopropionate hydrochloride have?

It has 2 Hydrogen Bond Donor Counts.

What is the Rotatable Bond Count of Ethyl 3-ethoxy-3-iminopropionate hydrochloride?

The Rotatable Bond Count is 6.

What is the Heavy Atom Count of Ethyl 3-ethoxy-3-iminopropionate hydrochloride?

The Heavy Atom Count is 12.

How is the Exact Mass of Ethyl 3-ethoxy-3-iminopropionate hydrochloride computed?

It is computed as 195.0662210 g/mol.

Does Ethyl 3-ethoxy-3-iminopropionate hydrochloride have any Defined Atom Stereocenter Count?

No, it has 0 Defined Atom Stereocenter Count.