Ethyl 2-hydroxy-4-methylpentanoate

• Catalog Number: ACMA00000434
• Category: Alcohols
• Molecular Weight: 160.21
• Molecular Formula: C₈H₁₁NO
• Hazard Statements: H302 + H332-H311-H315-H319-H335
• RIDADR: NONH for all modes of transport
• Symbol: GHS06

Custom Q&A

What is the molecular formula of Ethyl 2-hydroxy-4-methylpentanoate?

The molecular formula is C8H16O3.

What is the molecular weight of Ethyl 2-hydroxy-4-methylpentanoate?

The molecular weight is 160.21 g/mol.

What is the IUPAC name of Ethyl 2-hydroxy-4-methylpentanoate?

The IUPAC name is ethyl 2-hydroxy-4-methylpentanoate.

What is the InChI of Ethyl 2-hydroxy-4-methylpentanoate?

The InChI is InChI=1S/C8H16O3/c1-4-11-8(10)7(9)5-6(2)3/h6-7,9H,4-5H2,1-3H3.

What is the InChIKey of Ethyl 2-hydroxy-4-methylpentanoate?

The InChIKey is QRHOWVDPHIXNEN-UHFFFAOYSA-N.

What is the canonical SMILES of Ethyl 2-hydroxy-4-methylpentanoate?

The canonical SMILES is CCOC(=O)C(CC(C)C)O.

What is the CAS number of Ethyl 2-hydroxy-4-methylpentanoate?

The CAS number is 10348-47-7.

How many hydrogen bond donor counts are there in Ethyl 2-hydroxy-4-methylpentanoate?

There is 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts are there in Ethyl 2-hydroxy-4-methylpentanoate?

There are 3 hydrogen bond acceptor counts.