ethyl 2-(5-bromo-1-benzofuran-2-yl)acetate

• CAS: 408506-61-6
• Catalog Number: ACM408506616
• Category: Furans
• Molecular Weight: 283.12
• Molecular Formula: C12H11BrO3
• Boiling Point: 341.7±27.0°C/760 mmHg(lit.)
• Appearance: Pale yellow solid

Custom Q&A

What is the molecular formula of ethyl 2-(5-bromo-1-benzofuran-2-yl)acetate?

The molecular formula of ethyl 2-(5-bromo-1-benzofuran-2-yl)acetate is C12H11BrO3.

What is the molecular weight of ethyl 2-(5-bromo-1-benzofuran-2-yl)acetate?

The molecular weight of ethyl 2-(5-bromo-1-benzofuran-2-yl)acetate is 283.12 g/mol.

What is the IUPAC name of ethyl 2-(5-bromo-1-benzofuran-2-yl)acetate?

The IUPAC name of ethyl 2-(5-bromo-1-benzofuran-2-yl)acetate is ethyl 2-(5-bromo-1-benzofuran-2-yl)acetate.

What is the InChI of ethyl 2-(5-bromo-1-benzofuran-2-yl)acetate?

The InChI of ethyl 2-(5-bromo-1-benzofuran-2-yl)acetate is InChI=1S/C12H11BrO3/c1-2-15-12(14)7-10-6-8-5-9(13)3-4-11(8)16-10/h3-6H,2,7H2,1H3.

What is the InChIKey of ethyl 2-(5-bromo-1-benzofuran-2-yl)acetate?

The InChIKey of ethyl 2-(5-bromo-1-benzofuran-2-yl)acetate is DNRZNVWYIMRQGF-UHFFFAOYSA-N.

What is the Canonical SMILES of ethyl 2-(5-bromo-1-benzofuran-2-yl)acetate?

The Canonical SMILES of ethyl 2-(5-bromo-1-benzofuran-2-yl)acetate is CCOC(=O)CC1=CC2=C(O1)C=CC(=C2)Br.

What is the CAS number of ethyl 2-(5-bromo-1-benzofuran-2-yl)acetate?

The CAS number of ethyl 2-(5-bromo-1-benzofuran-2-yl)acetate is 408506-61-6.

How many hydrogen bond donor counts are there in ethyl 2-(5-bromo-1-benzofuran-2-yl)acetate?

There are 0 hydrogen bond donor counts in ethyl 2-(5-bromo-1-benzofuran-2-yl)acetate.

How many hydrogen bond acceptor counts are there in ethyl 2-(5-bromo-1-benzofuran-2-yl)acetate?

There are 3 hydrogen bond acceptor counts in ethyl 2-(5-bromo-1-benzofuran-2-yl)acetate.