What is the molecular formula of ethyl 1-benzyl-4-oxo-pyrrolidine-3-carboxylate?
The molecular formula is C14H17NO3.
What is the molecular weight of ethyl 1-benzyl-4-oxo-pyrrolidine-3-carboxylate?
The molecular weight is 247.29 g/mol.
What is the IUPAC name of ethyl 1-benzyl-4-oxo-pyrrolidine-3-carboxylate?
The IUPAC name is ethyl 1-benzyl-4-oxopyrrolidine-3-carboxylate.
What is the InChI of ethyl 1-benzyl-4-oxo-pyrrolidine-3-carboxylate?
The InChI is InChI=1S/C14H17NO3/c1-2-18-14(17)12-9-15(10-13(12)16)8-11-6-4-3-5-7-11/h3-7,12H,2,8-10H2,1H3.
What is the InChIKey of ethyl 1-benzyl-4-oxo-pyrrolidine-3-carboxylate?
The InChIKey is XLKXIFXOWMGWNT-UHFFFAOYSA-N.
What is the Canonical SMILES of ethyl 1-benzyl-4-oxo-pyrrolidine-3-carboxylate?
The Canonical SMILES is CCOC(=O)C1CN(CC1=O)CC2=CC=CC=C2.
What is the CAS number for ethyl 1-benzyl-4-oxo-pyrrolidine-3-carboxylate?
The CAS number is 1027-35-6.
What is the XLogP3-AA value for ethyl 1-benzyl-4-oxo-pyrrolidine-3-carboxylate?
The XLogP3-AA value is 1.8.
How many hydrogen bond acceptor count does ethyl 1-benzyl-4-oxo-pyrrolidine-3-carboxylate have?
It has 4 hydrogen bond acceptor counts.
Is ethyl 1-benzyl-4-oxo-pyrrolidine-3-carboxylate a canonicalized compound?
Yes, it is a canonicalized compound.