Ethanone,1-[3-(1-methylethenyl)phenyl]-(9ci)

• CAS: 87771-42-4
• Catalog Number: ACM87771424
• Category: Other Products
• Molecular Weight: 160.21238
• Molecular Formula: C₁₁H₁₂O
• Synonyms: Ethanone, 1-[3-(1-methylethenyl)phenyl]- (9CI);1-(3-prop-1-en-2-ylphenyl)ethanone

Custom Q&A

What is the molecular formula of Ethanone, 1-[3-(1-methylethenyl)phenyl]-?

The molecular formula is C11H12O.

How is Ethanone, 1-[3-(1-methylethenyl)phenyl]- also known?

It is also known as 1-(3-prop-1-en-2-ylphenyl)ethanone, m-isopropenylacetophenone, and SCHEMBL4105605.

What is the molecular weight of Ethanone, 1-[3-(1-methylethenyl)phenyl]-?

The molecular weight is 160.21 g/mol.

What is the IUPAC name of Ethanone, 1-[3-(1-methylethenyl)phenyl]-?

The IUPAC name is 1-(3-prop-1-en-2-ylphenyl)ethanone.

What is the InChI of Ethanone, 1-[3-(1-methylethenyl)phenyl]-?

The InChI is InChI=1S/C11H12O/c1-8(2)10-5-4-6-11(7-10)9(3)12/h4-7H,1H2,2-3H3.

What is the InChIKey of Ethanone, 1-[3-(1-methylethenyl)phenyl]-?

The InChIKey is CDWRSUNYLNEVTA-UHFFFAOYSA-N.

What is the Canonical SMILES of Ethanone, 1-[3-(1-methylethenyl)phenyl]-?

The Canonical SMILES is CC(=C)C1=CC(=CC=C1)C(=O)C.

How many hydrogen bond donor counts does Ethanone, 1-[3-(1-methylethenyl)phenyl]- have?

It has 0 hydrogen bond donor counts.

What is the topological polar surface area of Ethanone, 1-[3-(1-methylethenyl)phenyl]-?

The topological polar surface area is 17.1 Å2.

Is the compound Ethanone, 1-[3-(1-methylethenyl)phenyl]- canonicalized?

Yes, the compound is canonicalized.