Equilin methyl ether

• CAS: 6030-83-7
• Catalog Number: ACM6030837
• Category: Steroidal Compounds
• Molecular Weight: 282.38
• Molecular Formula: C₁₉H₂₂O₂

Custom Q&A

What is the molecular formula of equilin methyl ether?

The molecular formula of equilin methyl ether is C19H22O2.

What is the PubChem CID of equilin methyl ether?

The PubChem CID of equilin methyl ether is 133126662.

What is the IUPAC name of equilin methyl ether?

The IUPAC name of equilin methyl ether is (9R,13R,14R)-3-methoxy-13-methyl-9,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-one.

What is the molecular weight of equilin methyl ether?

The molecular weight of equilin methyl ether is 282.4 g/mol.

What is the InChI key of equilin methyl ether?

The InChI key of equilin methyl ether is DOLVDOAPSINHRR-KVSKMBFKSA-N.

What is the canonical SMILES of equilin methyl ether?

The canonical SMILES of equilin methyl ether is CC12CCC3C(=CCC4=C3C=CC(=C4)OC)C1CCC2=O.

How many hydrogen bond donor counts does equilin methyl ether have?

Equilin methyl ether has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does equilin methyl ether have?

Equilin methyl ether has 2 hydrogen bond acceptor counts.

How many rotatable bond counts does equilin methyl ether have?

Equilin methyl ether has 1 rotatable bond count.

Is equilin methyl ether a canonicalized compound in PubChem?

Yes, equilin methyl ether is a canonicalized compound in PubChem.