(E,E)-Methyl farnesoate

• CAS: 10485-70-8
• Catalog Number: ACM10485708
• Category: Other Products
• Molecular Weight: 250.38
• Molecular Formula: C₁₆H₂₆O₂
• Synonyms: METHYL-(2E,6E,10E)-3,7,11-TRIMETHYLDODECATRI-2,6,10-ENEOATE;(E,E)-METHYL FARNESOATE;2,6,10-Dodecatrienoic acid, 3,7,11-trimethyl-, methyl ester;Farnesyl methyl ester;Methyl (2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrienoate;methyl (E,E)-farnesate;Methyl 3,7,11-trimethyl-2,6,10-dodecatrienoate;Methyl farnesate

Custom Q&A

What is the molecular formula of methyl farnesoate?

The molecular formula of methyl farnesoate is C16H26O2.

What is the molecular weight of methyl farnesoate?

The molecular weight of methyl farnesoate is 250.38 g/mol.

What is the IUPAC name of methyl farnesoate?

The IUPAC name of methyl farnesoate is methyl (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoate.

What is the InChI of methyl farnesoate?

The InChI of methyl farnesoate is InChI=1S/C16H26O2/c1-13(2)8-6-9-14(3)10-7-11-15(4)12-16(17)18-5/h8,10,12H,6-7,9,11H2,1-5H3/b14-10+,15-12+.

What is the InChIKey of methyl farnesoate?

The InChIKey of methyl farnesoate is NWKXNIPBVLQYAB-VDQVFBMKSA-N.

What is the canonical SMILES of methyl farnesoate?

The canonical SMILES of methyl farnesoate is CC(=CCCC(=CCCC(=CC(=O)OC)C)C)C.

What is the CAS number of methyl farnesoate?

The CAS number of methyl farnesoate is 10485-70-8.

What is the ChEMBL ID of methyl farnesoate?

The ChEMBL ID of methyl farnesoate is CHEMBL171329.

What is the hydrogen bond donor count of methyl farnesoate?

The hydrogen bond donor count of methyl farnesoate is 0.

What is the hydrogen bond acceptor count of methyl farnesoate?

The hydrogen bond acceptor count of methyl farnesoate is 2.