Dl-alanine hydroxamate

• CAS: 16707-85-0
• Catalog Number: ACM16707850
• Category: Other Products
• Molecular Weight: 134.09074
• Molecular Formula: C₃H₆N₂O₄
• Synonyms: DL-ALANINE HYDROXAMATE

Custom Q&A

What is the molecular formula of Dl-alanine hydroxamate?

The molecular formula of Dl-alanine hydroxamate is C3H8N2O2.

What is the molecular weight of Dl-alanine hydroxamate?

The molecular weight of Dl-alanine hydroxamate is 104.11 g/mol.

What is the IUPAC name of Dl-alanine hydroxamate?

The IUPAC name of Dl-alanine hydroxamate is 2-amino-N-hydroxypropanamide.

What is the InChI of Dl-alanine hydroxamate?

The InChI of Dl-alanine hydroxamate is InChI=1S/C3H8N2O2/c1-2(4)3(6)5-7/h2,7H,4H2,1H3,(H,5,6).

What is the InChIKey of Dl-alanine hydroxamate?

The InChIKey of Dl-alanine hydroxamate is BAAQJFBTHFOHLY-UHFFFAOYSA-N.

How many hydrogen bond donor counts does Dl-alanine hydroxamate have?

Dl-alanine hydroxamate has 3 hydrogen bond donor counts.

What is the XLogP3-AA value of Dl-alanine hydroxamate?

The XLogP3-AA value of Dl-alanine hydroxamate is -1.5.

What is the topological polar surface area of Dl-alanine hydroxamate?

The topological polar surface area of Dl-alanine hydroxamate is 75.4 Ų.

How many rotatable bond counts does Dl-alanine hydroxamate have?

Dl-alanine hydroxamate has 1 rotatable bond count.

Is the compound canonicalized?

Yes, the compound is canonicalized.