CAS
114446-55-8 Purity
---
114446-55-8 Purity
---
Inquiry Basket
DL-3-Amino-3-(3-Bromo-phenyl)-propionic acid
CAS
117391-50-1
Catalog Number
ACM117391501
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of DL-3-Amino-3-(3-Bromo-phenyl)-propionic acid?
The molecular formula is C9H10BrNO2.
What is the molecular weight of DL-3-Amino-3-(3-Bromo-phenyl)-propionic acid?
The molecular weight is 244.08 g/mol.
What is the IUPAC name of DL-3-Amino-3-(3-Bromo-phenyl)-propionic acid?
The IUPAC name is 3-amino-3-(3-bromophenyl)propanoic acid.
What is the InChI of DL-3-Amino-3-(3-Bromo-phenyl)-propionic acid?
The InChI is InChI=1S/C9H10BrNO2/c10-7-3-1-2-6(4-7)8(11)5-9(12)13/h1-4,8H,5,11H2,(H,12,13).
What is the InChIKey of DL-3-Amino-3-(3-Bromo-phenyl)-propionic acid?
The InChIKey is RLYAXKJHJUXZOT-UHFFFAOYSA-N.
What is the Canonical SMILES of DL-3-Amino-3-(3-Bromo-phenyl)-propionic acid?
The Canonical SMILES is C1=CC(=CC(=C1)Br)C(CC(=O)O)N.
What is the CAS number of DL-3-Amino-3-(3-Bromo-phenyl)-propionic acid?
The CAS number is 275826-35-2.
How many hydrogen bond donor counts does DL-3-Amino-3-(3-Bromo-phenyl)-propionic acid have?
It has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does DL-3-Amino-3-(3-Bromo-phenyl)-propionic acid have?
It has 3 hydrogen bond acceptor counts.
What is the topological polar surface area of DL-3-Amino-3-(3-Bromo-phenyl)-propionic acid?
The topological polar surface area is 63.3 Ų.
Recommended Products
