CAS
68302-57-8 Purity
---
68302-57-8 Purity
---
Inquiry Basket
Dioctylphosphinic acid
CAS
683-19-2
Catalog Number
ACM683192
Category
Other Products
Molecular Weight
290.421661
Molecular Formula
C16H35O2P
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
dioctylphosphinic acid;Einecs 211-671-6
What is the molecular formula of Dioctylphosphinic acid?
The molecular formula of Dioctylphosphinic acid is C16H35O2P.
What is the molecular weight of Dioctylphosphinic acid?
The molecular weight of Dioctylphosphinic acid is 290.42 g/mol.
What is the IUPAC Name of Dioctylphosphinic acid?
The IUPAC Name of Dioctylphosphinic acid is dioctylphosphinic acid.
What is the InChIKey of Dioctylphosphinic acid?
The InChIKey of Dioctylphosphinic acid is YTMRJBAHYSIRMZ-UHFFFAOYSA-N.
What is the Canonical SMILES of Dioctylphosphinic acid?
The Canonical SMILES of Dioctylphosphinic acid is CCCCCCCCP(=O)(CCCCCCCC)O.
What is the CAS number for Dioctylphosphinic acid?
The CAS number for Dioctylphosphinic acid is 683-19-2.
How many hydrogen bond donor counts does Dioctylphosphinic acid have?
Dioctylphosphinic acid has 1 hydrogen bond donor count.
What is the hydrogen bond acceptor count of Dioctylphosphinic acid?
The hydrogen bond acceptor count of Dioctylphosphinic acid is 2.
How many rotatable bond counts does Dioctylphosphinic acid have?
Dioctylphosphinic acid has 14 rotatable bond counts.
Is Compound Is Canonicalized for Dioctylphosphinic acid?
Yes, the Compound Is Canonicalized for Dioctylphosphinic acid is Yes.
Recommended Products
CAS
68308-64-5 Purity
---
68308-64-5 Purity
---
![Diammonium bis[carbonato-o]dihydroxyzirconate](https://resource.alfa-chemistry.com/structure/68309-95-5.gif)
