Dinonylnaphthalenedisulfonic acid

CAS

60223-95-2

Catalog Number

ACM60223952

Category

Polymer/Macromolecule

Molecular Weight

540.78

Molecular Formula

C₂₈H₄₄O₆S₂

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

dinonyl-naphthalenedisulfonicaci;dinonylnaphthalenedisulfonicacidsolution;DINONYLNAPHTHALENEDISULFONIC ACID;dinonylnaphthalenedisulphonic acid;DINONYLNAPHTHALENEDISULFONIC ACID, 55 WT;Naphthalenedisulfonic acid, dinonyl-;DNNDSA (DINONYLNAPHTHALENEDISULFON

What is the molecular formula of Dinonylnaphthalenedisulfonic acid?

The molecular formula of Dinonylnaphthalenedisulfonic acid is C28H44O6S2.

What are the synonyms for Dinonylnaphthalenedisulfonic acid?

The synonyms for Dinonylnaphthalenedisulfonic acid are 2,6-DINONYLNAPHTHALENE-1,5-DISULFONIC ACID and SCHEMBL20803573.

What is the molecular weight of Dinonylnaphthalenedisulfonic acid?

The molecular weight of Dinonylnaphthalenedisulfonic acid is 540.8 g/mol.

What is the IUPAC name of Dinonylnaphthalenedisulfonic acid?

The IUPAC name of Dinonylnaphthalenedisulfonic acid is 2,6-di(nonyl)naphthalene-1,5-disulfonic acid.

What is the InChI of Dinonylnaphthalenedisulfonic acid?

The InChI of Dinonylnaphthalenedisulfonic acid is InChI=1S/C28H44O6S2/c1-3-5-7-9-11-13-15-17-23-19-21-26-25(27(23)35(29,30)31)22-20-24(28(26)36(32,33)34)18-16-14-12-10-8-6-4-2/h19-22H,3-18H2,1-2H3,(H,29,30,31)(H,32,33,34).

What is the InChIKey of Dinonylnaphthalenedisulfonic acid?

The InChIKey of Dinonylnaphthalenedisulfonic acid is KVOYCYJHAKSFSR-UHFFFAOYSA-N.

What is the canonical SMILES representation of Dinonylnaphthalenedisulfonic acid?

The canonical SMILES representation of Dinonylnaphthalenedisulfonic acid is CCCCCCCCCC1=C(C2=C(C=C1)C(=C(C=C2)CCCCCCCCC)S(=O)(=O)O)S(=O)(=O)O.

What is the XLogP3-AA value of Dinonylnaphthalenedisulfonic acid?

The XLogP3-AA value of Dinonylnaphthalenedisulfonic acid is 9.8.

How many hydrogen bond donor counts does Dinonylnaphthalenedisulfonic acid have?

Dinonylnaphthalenedisulfonic acid has 2 hydrogen bond donor counts.

How many rotatable bond counts does Dinonylnaphthalenedisulfonic acid have?

Dinonylnaphthalenedisulfonic acid has 18 rotatable bond counts.