D-(+)-Digitoxose

• CAS: 527-52-6
• Catalog Number: ACM527526
• Category: Other Products
• Molecular Weight: 148.16
• Molecular Formula: C₆H₁₂O₄
• Synonyms: D-(+)-DIGITOXOSE;D-DIGITOXOSE;DIGITOXOSE;DIGITOXOSE, D-(+)-;2,6-DI-DEOXY-D-RIBOHEXOSE;2,6-DIDEOXY-D-RIBOSE;2,6-DI-DEOXY-D-RIBOTHEXOSE;2,6-dideoxy-D-altrose
• Melting Point: 98-100°C

Custom Q&A

What is the molecular formula of D-(+)-Digitoxose?

The molecular formula of D-(+)-Digitoxose is C6H12O4.

What is the molecular weight of D-(+)-Digitoxose?

The molecular weight of D-(+)-Digitoxose is 148.16 g/mol.

What is the IUPAC name of D-(+)-Digitoxose?

The IUPAC name of D-(+)-Digitoxose is (3S,4R,5R)-3,4,5-trihydroxyhexanal.

What is the InChI of D-(+)-Digitoxose?

The InChI of D-(+)-Digitoxose is InChI=1S/C6H12O4/c1-4(8)6(10)5(9)2-3-7/h3-6,8-10H,2H2,1H3/t4-,5+,6-/m1/s1.

What is the InChIKey of D-(+)-Digitoxose?

The InChIKey of D-(+)-Digitoxose is JWFRNGYBHLBCMB-NGJCXOISSA-N.

What is the canonical SMILES of D-(+)-Digitoxose?

The canonical SMILES of D-(+)-Digitoxose is CC(C(C(CC=O)O)O)O.

How many hydrogen bond donor counts does D-(+)-Digitoxose have?

D-(+)-Digitoxose has 3 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does D-(+)-Digitoxose have?

D-(+)-Digitoxose has 4 hydrogen bond acceptor counts.

What is the topological polar surface area of D-(+)-Digitoxose?

The topological polar surface area of D-(+)-Digitoxose is 77.8 ?2.

How many defined atom stereocenter counts does D-(+)-Digitoxose have?

D-(+)-Digitoxose has 3 defined atom stereocenter counts.