Crepenynic acid

• CAS: 13214-35-2
• Catalog Number: ACM13214352
• Category: Other Products
• Molecular Weight: 278.433
• Molecular Formula: C₁₈H₃₀O₂

Custom Q&A

What is the molecular formula of crepenynic acid?

The molecular formula of crepenynic acid is C18H30O2.

What is the molecular weight of crepenynic acid?

The molecular weight of crepenynic acid is 278.4 g/mol.

What is the IUPAC name of crepenynic acid?

The IUPAC name of crepenynic acid is (Z)-octadec-9-en-12-ynoic acid.

What is the InChI of crepenynic acid?

The InChI of crepenynic acid is InChI=1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-5,8,11-17H2,1H3,(H,19,20)/b10-9-.

What is the InChIKey of crepenynic acid?

The InChIKey of crepenynic acid is SAOSKFBYQJLQOS-KTKRTIGZSA-N.

What is the canonical SMILES of crepenynic acid?

The canonical SMILES of crepenynic acid is CCCCCC#CCC=CCCCCCCCC(=O)O.

What is the CAS number of crepenynic acid?

The CAS number of crepenynic acid is 2277-31-8.

What is the Lipid Maps ID of crepenynic acid?

The Lipid Maps ID of crepenynic acid is LMFA01030742.

What is the XLogP3-AA value of crepenynic acid?

The XLogP3-AA value of crepenynic acid is 6.3.

How many rotatable bonds does crepenynic acid have?

Crepenynic acid has 12 rotatable bonds.