Costic acid

• CAS: 3650-43-9
• Catalog Number: ACM3650439
• Category: Other Products
• Molecular Weight: 234.33398
• Molecular Formula: C₁₅H₂₂O₂
• Synonyms: (2R,8aβ)-Decahydro-4aα-methyl-α,8-bis(methylene)-2α-naphthaleneacetic acid;beta-Costic acid;(2R,4aR,8aS)-Decahydro-4a-methyl-alpha,8-bis(methylene)-2-naphthaleneacetic acid;Costus acid
• Melting Point: 87-88°C

Custom Q&A

What is the molecular formula of Costic acid?

The molecular formula of Costic acid is C15H22O2.

What is the molecular weight of Costic acid?

The molecular weight of Costic acid is 234.33 g/mol.

What is the IUPAC name of Costic acid?

The IUPAC name of Costic acid is 2-[(2R,4aR,8aS)-4a-methyl-8-methylidene-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl]prop-2-enoic acid.

What is the InChI key of Costic acid?

The InChI key of Costic acid is UJQGVDNQDFTTLZ-VNHYZAJKSA-N.

What is the Canonical SMILES of Costic acid?

The Canonical SMILES of Costic acid is CC12CCCC(=C)C1CC(CC2)C(=C)C(=O)O.

What is the CAS number of Costic acid?

The CAS number of Costic acid is 3650-43-9.

What is the XLogP3-AA value of Costic acid?

The XLogP3-AA value of Costic acid is 4.1.

How many hydrogen bond donor counts does Costic acid have?

Costic acid has 1 hydrogen bond donor count.

What is the topological polar surface area of Costic acid?

The topological polar surface area of Costic acid is 37.3 Ų.

How many defined atom stereocenter counts does Costic acid have?

Costic acid has 3 defined atom stereocenter counts.