cis-2,4,5-Trimethoxy-1-propenylbenzene

• CAS: 5273-86-9
• Catalog Number: ACM5273869
• Category: Alkenes
• Molecular Weight: 208.25
• Hazard Statements: H315-H319-H335
• RIDADR: UN 3295C 3 / PGIII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of cis-2,4,5-Trimethoxy-1-propenylbenzene?

The molecular formula is C12H16O3.

What is the molecular weight of cis-2,4,5-Trimethoxy-1-propenylbenzene?

The molecular weight is 208.25 g/mol.

What is the IUPAC name of cis-2,4,5-Trimethoxy-1-propenylbenzene?

The IUPAC name is 1,2,4-trimethoxy-5-[(Z)-prop-1-enyl]benzene.

What is the InChI of cis-2,4,5-Trimethoxy-1-propenylbenzene?

The InChI is InChI=1S/C12H16O3/c1-5-6-9-7-11(14-3)12(15-4)8-10(9)13-2/h5-8H,1-4H3/b6-5-.

What is the InChIKey of cis-2,4,5-Trimethoxy-1-propenylbenzene?

The InChIKey is RKFAZBXYICVSKP-WAYWQWQTSA-N.

What is the canonical SMILES of cis-2,4,5-Trimethoxy-1-propenylbenzene?

The canonical SMILES is CC=CC1=CC(=C(C=C1OC)OC)OC.

What is another identifier for cis-2,4,5-Trimethoxy-1-propenylbenzene?

The CAS number for cis-2,4,5-Trimethoxy-1-propenylbenzene is 5273-86-9.

What is the EC number for cis-2,4,5-Trimethoxy-1-propenylbenzene?

The EC number is 226-096-6.

How many hydrogen bond acceptors are there in cis-2,4,5-Trimethoxy-1-propenylbenzene?

There are 3 hydrogen bond acceptors.

How many rotatable bonds are there in cis-2,4,5-Trimethoxy-1-propenylbenzene?

There are 4 rotatable bonds.