Ciclesonide

• CAS: 141845-82-1
• Catalog Number: ACM141845821
• Category: Steroidal Compounds
• Molecular Weight: 540.69
• Molecular Formula: C₃₂H₄₄O₇
• IUPAC Name: AC1MIWNR
• Exact Mass: 540.30900

Custom Q&A

What is the molecular formula of ciclesonide?

The molecular formula of ciclesonide is C32H44O7.

What is the molecular weight of ciclesonide?

The molecular weight of ciclesonide is 540.7 g/mol.

What are some synonyms for ciclesonide?

Some synonyms for ciclesonide are Alvesco, Omnaris, and Zetonna.

How is ciclesonide administered for treatment?

Ciclesonide is administered by oral inhalation into the lungs.

What is the active metabolite of ciclesonide?

The active metabolite of ciclesonide is desisobutyryl-ciclesonide (des-CIC).

How does ciclesonide work in the body?

Ciclesonide binds to intracellular glucocorticoid receptors and regulates gene expressions, leading to inhibitory activities against multiple cell types and various mediators associated with inflammation.

What is the InChIKey for ciclesonide?

The InChIKey for ciclesonide is LUKZNWIVRBCLON-GXOBDPJESA-N.

What is the Canonical SMILES representation of ciclesonide?

The Canonical SMILES representation of ciclesonide is CC(C)C(=O)OCC(=O)C12C(CC3C1(CC(C4C3CCC5=CC(=O)C=CC45C)O)C)OC(O2)C6CCCCC6.

What is the CAS number for ciclesonide?

The CAS number for ciclesonide is 126544-47-6.

What is the primary use of ciclesonide in medical treatment?

Ciclesonide is primarily used as a glucocorticoid to treat obstructive airway diseases.