What is the molecular formula of Acetamide, N-(1-ethyl-2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)?
The molecular formula is C11H13N3O2.
What is the molecular weight of Acetamide, N-(1-ethyl-2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)?
The molecular weight is 219.24 g/mol.
What is the IUPAC name of Acetamide, N-(1-ethyl-2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)?
The IUPAC name is N-(1-ethyl-2-oxo-3H-benzimidazol-5-yl)acetamide.
What is the InChI key of Acetamide, N-(1-ethyl-2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)?
The InChI key is MZQNDWLGZSNEOA-UHFFFAOYSA-N.
What is the canonical SMILES representation of Acetamide, N-(1-ethyl-2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)?
The canonical SMILES is CCN1C2=C(C=C(C=C2)NC(=O)C)NC1=O.
What is the CAS number of Acetamide, N-(1-ethyl-2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)?
The CAS number is 99857-17-7.
What is the XLogP3-AA value of Acetamide, N-(1-ethyl-2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)?
The XLogP3-AA value is 0.3.
What is the hydrogen bond donor count of Acetamide, N-(1-ethyl-2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)?
The hydrogen bond donor count is 2.
What is the topological polar surface area of Acetamide, N-(1-ethyl-2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)?
The topological polar surface area is 61.4 Å2.
Is Acetamide, N-(1-ethyl-2,3-dihydro-2-oxo-1H-benzimidazol-5-yl) a canonicalized compound?
Yes, it is a canonicalized compound.