CAS
99848-78-9 Purity
96%
99848-78-9 Purity
96%
Inquiry Basket
2-Chloro-3,4-dimethoxycinnamic acid
CAS
99854-17-8
Catalog Number
ACM99854178
Category
Other Products
Molecular Weight
242.66
Molecular Formula
C11H11ClO4
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Chloro-3,4-dimethoxycinnamic acid?
The molecular formula of 2-Chloro-3,4-dimethoxycinnamic acid is C11H11ClO4.
What is the molecular weight of 2-Chloro-3,4-dimethoxycinnamic acid?
The molecular weight of 2-Chloro-3,4-dimethoxycinnamic acid is 242.65 g/mol.
What is the CAS number of 2-Chloro-3,4-dimethoxycinnamic acid?
The CAS number of 2-Chloro-3,4-dimethoxycinnamic acid is 99854-17-8.
What is the IUPAC name of 2-Chloro-3,4-dimethoxycinnamic acid?
The IUPAC name of 2-Chloro-3,4-dimethoxycinnamic acid is (E)-3-(2-chloro-3,4-dimethoxyphenyl)prop-2-enoic acid.
What is the InChI of 2-Chloro-3,4-dimethoxycinnamic acid?
The InChI of 2-Chloro-3,4-dimethoxycinnamic acid is InChI=1S/C11H11ClO4/c1-15-8-5-3-7(4-6-9(13)14)10(12)11(8)16-2/h3-6H,1-2H3,(H,13,14)/b6-4+.
What is the InChIKey of 2-Chloro-3,4-dimethoxycinnamic acid?
The InChIKey of 2-Chloro-3,4-dimethoxycinnamic acid is JIPTVEJKXDVECY-GQCTYLIASA-N.
What is the canonical SMILES of 2-Chloro-3,4-dimethoxycinnamic acid?
The canonical SMILES of 2-Chloro-3,4-dimethoxycinnamic acid is COC1=C(C(=C(C=C1)C=CC(=O)O)Cl)OC.
What is the XLogP3-AA value of 2-Chloro-3,4-dimethoxycinnamic acid?
The XLogP3-AA value of 2-Chloro-3,4-dimethoxycinnamic acid is 2.4.
What is the hydrogen bond donor count of 2-Chloro-3,4-dimethoxycinnamic acid?
The hydrogen bond donor count of 2-Chloro-3,4-dimethoxycinnamic acid is 1.
What is the hydrogen bond acceptor count of 2-Chloro-3,4-dimethoxycinnamic acid?
The hydrogen bond acceptor count of 2-Chloro-3,4-dimethoxycinnamic acid is 4.
Recommended Products
![8-Chloromethyl-6-nitro-4H-benzo[1,3]dioxine](https://resource.alfa-chemistry.com/structure/99849-17-9.gif)
CAS
99849-94-2 Purity
ca. 97%
99849-94-2 Purity
ca. 97%
