CAS
99827-73-3 Purity
---
99827-73-3 Purity
---
If you have any other questions or need other size, please get a quote.
The molecular formula is C14H12O5.
Some synonyms include Benzeneacetic acid, 4-((5-formyl-2-furanyl)oxy)-, methyl ester, and MethyI 2-[4-[(5-FORMYL-2-FURYL)OXY]PHENYL]ACETATE.
The molecular weight is 260.24 g/mol.
The IUPAC name is methyl 2-[4-(5-formylfuran-2-yl)oxyphenyl]acetate.
COC(=O)CC1=CC=C(C=C1)OC2=CC=C(O2)C=O
HVYOAAMXDAPPLF-UHFFFAOYSA-N
The XLogP3-AA value is 2.4.
There are 5 hydrogen bond acceptors.
The topological polar surface area is 65.7 Ų.
Yes, the compound is canonicalized.