What is the molecular formula of Methyl 2-[4-[(5-formyl-2-furyl)oxy]phenyl]acetate?
The molecular formula is C14H12O5.
What are some synonyms for Methyl 2-[4-[(5-formyl-2-furyl)oxy]phenyl]acetate?
Some synonyms include Benzeneacetic acid, 4-((5-formyl-2-furanyl)oxy)-, methyl ester, and MethyI 2-[4-[(5-FORMYL-2-FURYL)OXY]PHENYL]ACETATE.
What is the molecular weight of Methyl 2-[4-[(5-formyl-2-furyl)oxy]phenyl]acetate?
The molecular weight is 260.24 g/mol.
What is the IUPAC name of Methyl 2-[4-[(5-formyl-2-furyl)oxy]phenyl]acetate?
The IUPAC name is methyl 2-[4-(5-formylfuran-2-yl)oxyphenyl]acetate.
What is the Canonical SMILES representation of Methyl 2-[4-[(5-formyl-2-furyl)oxy]phenyl]acetate?
COC(=O)CC1=CC=C(C=C1)OC2=CC=C(O2)C=O
What is the InChIKey of Methyl 2-[4-[(5-formyl-2-furyl)oxy]phenyl]acetate?
HVYOAAMXDAPPLF-UHFFFAOYSA-N
What is the XLogP3-AA value of Methyl 2-[4-[(5-formyl-2-furyl)oxy]phenyl]acetate?
The XLogP3-AA value is 2.4.
How many hydrogen bond acceptors are present in Methyl 2-[4-[(5-formyl-2-furyl)oxy]phenyl]acetate?
There are 5 hydrogen bond acceptors.
What is the topological polar surface area of Methyl 2-[4-[(5-formyl-2-furyl)oxy]phenyl]acetate?
The topological polar surface area is 65.7 Ų.
Is the compound canonicalized?
Yes, the compound is canonicalized.