CAS
996-05-4 Purity
96%
996-05-4 Purity
96%
Inquiry Basket
5-(Hydroxyimino)-4-methoxy-2-(pivaloylimino)thiazolidine-3-acetamide
CAS
99610-84-1
Catalog Number
ACM99610841
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C11H18N4O4S.
What are the synonyms of the compound?
The synonyms of the compound are 5-(Hydroxyimino)-4-methoxy-2-(pivaloylimino)thiazolidine-3-acetamide.
What is the molecular weight of the compound?
The molecular weight of the compound is 302.35 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is N-[3-(2-amino-2-oxoethyl)-5-hydroxyimino-4-methoxy-1,3-thiazolidin-2-ylidene]-2,2-dimethylpropanamide.
What is the InChI of the compound?
The InChI of the compound is: InChI=1S/C11H18N4O4S/c1-11(2,3)9(17)13-10-15(5-6(12)16)8(19-4)7(14-18)20-10/h8,18H,5H2,1-4H3,(H2,12,16).
What is the InChIKey of the compound?
The InChIKey of the compound is KYSSQRVLHARZJQ-UHFFFAOYSA-N.
What is the canonical SMILES notation of the compound?
The canonical SMILES notation of the compound is CC(C)(C)C(=O)N=C1N(C(C(=NO)S1)OC)CC(=O)N.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 0.9.
How many hydrogen bond donor counts does the compound have?
The compound has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 6 hydrogen bond acceptor counts.
Recommended Products
![1,2,3,9-Tetrahydro-3-[(2-methyl-1H-imidazole-1-yl)methyl]-4H-carbazol-4-one](https://resource.alfa-chemistry.com/structure/99614-14-9.gif)
CAS
99614-14-9 Purity
---
99614-14-9 Purity
---
