99584-03-9 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C8H8N2OS.
The molecular weight of the compound is 180.23 g/mol.
The IUPAC name of the compound is 5-amino-2-methyl-1,3-benzothiazol-6-ol.
The InChI of the compound is InChI=1S/C8H8N2OS/c1-4-10-6-2-5(9)7(11)3-8(6)12-4/h2-3,11H,9H2,1H3.
The InChIKey of the compound is YOQVQAWAEQOUAM-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC1=NC2=C(S1)C=C(C(=C2)N)O.
The CAS number of the compound is 99584-08-4.
The XLogP3-AA value of the compound is 1.7.
The compound has 2 hydrogen bond donor count.
The compound has 4 hydrogen bond acceptor count.