What is the molecular formula of 7-Amino-2,3-dihydro-1,4-benzodioxin-6-carboxylic acid?
The molecular formula is C9H9NO4.
What is the molecular weight of 7-Amino-2,3-dihydro-1,4-benzodioxin-6-carboxylic acid?
The molecular weight is 195.17 g/mol.
What are some synonyms for 7-Amino-2,3-dihydro-1,4-benzodioxin-6-carboxylic acid?
Some synonyms include 99358-09-5, 7-amino-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid, and 7-Amino-2,3-dihydro-benzo[1,4]dioxine-6-carboxylic acid.
When was 7-Amino-2,3-dihydro-1,4-benzodioxin-6-carboxylic acid created?
It was created on 2005-08-09.
What is the IUPAC name of 7-Amino-2,3-dihydro-1,4-benzodioxin-6-carboxylic acid?
The IUPAC name is 6-amino-2,3-dihydro-1,4-benzodioxine-7-carboxylic acid.
What is the InChI of 7-Amino-2,3-dihydro-1,4-benzodioxin-6-carboxylic acid?
The InChI is InChI=1S/C9H9NO4/c10-6-4-8-7(13-1-2-14-8)3-5(6)9(11)12/h3-4H,1-2,10H2,(H,11,12).
What is the InChIKey of 7-Amino-2,3-dihydro-1,4-benzodioxin-6-carboxylic acid?
The InChIKey is HYJPNUZJSIEYGD-UHFFFAOYSA-N.
What is the Canonical SMILES of 7-Amino-2,3-dihydro-1,4-benzodioxin-6-carboxylic acid?
The Canonical SMILES is C1COC2=C(O1)C=C(C(=C2)N)C(=O)O.
What is the XLogP3-AA value of 7-Amino-2,3-dihydro-1,4-benzodioxin-6-carboxylic acid?
The XLogP3-AA value is 1.
How many hydrogen bond acceptors does 7-Amino-2,3-dihydro-1,4-benzodioxin-6-carboxylic acid have?
It has 5 hydrogen bond acceptors.